(R)-N,N-DIMETHYL-1-[(S)-2-(DIPHENYLPHOSPHINO)FERROCENYL]ETHYLAMINE manufacturers
|
| | (R)-N,N-DIMETHYL-1-[(S)-2-(DIPHENYLPHOSPHINO)FERROCENYL]ETHYLAMINE Basic information |
| | (R)-N,N-DIMETHYL-1-[(S)-2-(DIPHENYLPHOSPHINO)FERROCENYL]ETHYLAMINE Chemical Properties |
| Melting point | 141-143 °C(lit.) | | alpha | -355 º (C=0.6 IN ETOH) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | solid | | color | Light yellow to Yellow to Orange | | Optical Rotation | [α]20/D 355°, c = 0.6 in ethanol | | Water Solubility | Insoluble in water. | | Sensitive | Air Sensitive | | InChI | 1S/C21H23NP.C5H5.Fe/c1-17(22(2)3)20-15-10-16-21(20)23(18-11-6-4-7-12-18)19-13-8-5-9-14-19;1-2-4-5-3-1;/h4-17H,1-3H3;1-5H;/t17-;;/m1../s1 | | InChIKey | RCAFPSZHKFOLEE-ZEECNFPPSA-N | | SMILES | [Fe].[CH]1[CH][CH][CH][CH]1.C[C@H]([C]2[CH][CH][CH][C]2P(c3ccccc3)c4ccccc4)N(C)C |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36-36/37/38 | | RIDADR | 3288 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (R)-N,N-DIMETHYL-1-[(S)-2-(DIPHENYLPHOSPHINO)FERROCENYL]ETHYLAMINE Usage And Synthesis |
| Chemical Properties | Yellow solid | | Uses | Ligand used in the enantioselective vinylation of aldehydes. | | Application | (R)-N,N-dimethyl-1-[(s)-2-(diphenylphosphino)ferrocenyl]ethylamine is an effective chiral phosphine ligand for nickel- or palladium-catalyzed asymmetric cross-couplings of organomagnesium or zinc reagents with alkenyl bromides and for palladium-catalyzed asymmetric hydrosilylations of 1,3-dienes. | | reaction suitability | reaction type: Asymmetric synthesis reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand reaction type: Cross Couplings | | storage | stable in air for years, but best kept sealed in a refrigerator. |
| | (R)-N,N-DIMETHYL-1-[(S)-2-(DIPHENYLPHOSPHINO)FERROCENYL]ETHYLAMINE Preparation Products And Raw materials |
|