| Company Name: |
LANSPHARMA
|
| Tel: |
+91-9000766909 |
| Email: |
info@lanspharma.com |
| Products Intro: |
Product Name:methyl 3-(2-(methylamino)ethyl)benzoate
CAS:1093938-04-5
Purity:98% Package:1 g, 10 g, 50 g, 100 g, 1 Kg
|
| Company Name: |
Shandong Xingzhi Biological Medicine Co. LTD Gold
|
| Tel: |
18366166027 |
| Email: |
xingzhi@xingzhipharm.com |
| Products Intro: |
Product Name:Methyl 3-[2-(methylamino)ethyl]benzoate
CAS:1093938-04-5
Purity:95% Package:1kg;100g;10g
|
|
| | Methyl 3-[2-(methylamino)ethyl]benzoate HCl Basic information |
| | Methyl 3-[2-(methylamino)ethyl]benzoate HCl Chemical Properties |
| Boiling point | 295.4±23.0 °C(Predicted) | | density | 1.041±0.06 g/cm3(Predicted) | | pka | 10.11±0.10(Predicted) | | InChI | InChI=1S/C11H15NO2/c1-12-7-6-9-4-3-5-10(8-9)11(13)14-2/h3-5,8,12H,6-7H2,1-2H3 | | InChIKey | QLWTYAUQMLYTCW-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=CC(CCNC)=C1 |
| | Methyl 3-[2-(methylamino)ethyl]benzoate HCl Usage And Synthesis |
| | Methyl 3-[2-(methylamino)ethyl]benzoate HCl Preparation Products And Raw materials |
|