2,2,2-TRIFLUORO-N-PHENYLACETAMIDE manufacturers
|
| | 2,2,2-TRIFLUORO-N-PHENYLACETAMIDE Basic information |
| Product Name: | 2,2,2-TRIFLUORO-N-PHENYLACETAMIDE | | Synonyms: | 2-(2-benzotriazolyl)-4,6-ditert-butylphenol;2,2,2-Trifluoroacetanilide;Acetanilide, 2,2,2-trifluoro-;alpha,alpha,alpha-Trifluoroacetanilide;N-TRIFLUOROACETYLANILINE;TRIFLUOROACETANILIDE;2,2,2-TRIFLUORO-N-PHENYLACETAMIDE;Trifluroracetanilide | | CAS: | 404-24-0 | | MF: | C8H6F3NO | | MW: | 189.13 | | EINECS: | 206-965-6 | | Product Categories: | | | Mol File: | 404-24-0.mol |  |
| | 2,2,2-TRIFLUORO-N-PHENYLACETAMIDE Chemical Properties |
| Melting point | 86-90 °C | | Boiling point | 220-225 °C | | density | 1.3305 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 10.05±0.70(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C8H6F3NO/c9-8(10,11)7(13)12-6-4-2-1-3-5-6/h1-5H,(H,12,13) | | InChIKey | SAPQIENQEZURNZ-UHFFFAOYSA-N | | SMILES | C(NC1=CC=CC=C1)(=O)C(F)(F)F | | CAS DataBase Reference | 404-24-0(CAS DataBase Reference) | | NIST Chemistry Reference | Acetamide, 2,2,2-trifluoro-N-phenyl-(404-24-0) |
| Hazard Codes | Xi | | Safety Statements | 24/25-22 | | HazardClass | IRRITANT | | HS Code | 29223900 |
| Provider | Language |
|
ACROS
| English |
| | 2,2,2-TRIFLUORO-N-PHENYLACETAMIDE Usage And Synthesis |
| Chemical Properties | White or light brown crystalline powder | | Synthesis Reference(s) | Canadian Journal of Chemistry, 43, p. 541, 1965 DOI: 10.1139/v65-071 |
| | 2,2,2-TRIFLUORO-N-PHENYLACETAMIDE Preparation Products And Raw materials |
|