|
|
| | Diethyl bis(2-hydroxyethyl)aminomethylphosphonate Basic information |
| Product Name: | Diethyl bis(2-hydroxyethyl)aminomethylphosphonate | | Synonyms: | DIETHYL BIS(2-HYDROXYETHYL)AMINO METHYL PHOSPHONATE;O,O-Diethyl-n,n-bis(2-hydroxyethyl) aminomethyl phosphonate;Phosphonic acid, [[bis(2-hydroxyethyl) amino]methyl]-, diethyl ester;diethyl N,N-bis(hydroxyethyl)aminomethyl phosphonate;2-(Diethoxyphosphorylmethyl-(2-hydroxyethyl)amino)ethanol;Diethyl (N,N-bis(2-hydroxyethyl)amino)methanephosphonoate;O,O-Diethyl [[bis(2-hydroxyethyl)amino]methyl]phosphonate;[[Bis(2-hydroxyethyl)amino]methyl]phosphonic acid diethyl ester | | CAS: | 2781-11-5 | | MF: | C9H22NO5P | | MW: | 255.25 | | EINECS: | 220-482-8 | | Product Categories: | 1 | | Mol File: | 2781-11-5.mol |  |
| | Diethyl bis(2-hydroxyethyl)aminomethylphosphonate Chemical Properties |
| Boiling point | 150 °C(Press: 0.1 Torr) | | density | 1.180±0.06 g/cm3(Predicted) | | vapor pressure | 0Pa at 25℃ | | storage temp. | 2-8°C, protect from light | | pka | 14.31±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | Water Solubility | 1000g/L | | InChI | InChI=1S/C9H22NO5P/c1-3-14-16(13,15-4-2)9-10(5-7-11)6-8-12/h11-12H,3-9H2,1-2H3 | | InChIKey | CCJKFLLIJCGHMO-UHFFFAOYSA-N | | SMILES | P(CN(CCO)CCO)(=O)(OCC)OCC | | LogP | -1.938 | | EPA Substance Registry System | Phosphonic acid, [[bis(2-hydroxyethyl)amino]methyl]-, diethyl ester (2781-11-5) |
| | Diethyl bis(2-hydroxyethyl)aminomethylphosphonate Usage And Synthesis |
| | Diethyl bis(2-hydroxyethyl)aminomethylphosphonate Preparation Products And Raw materials |
|