|
|
| | 4,4'-Bis(methoxymethyl)-1,1'-biphenyl Basic information |
| Product Name: | 4,4'-Bis(methoxymethyl)-1,1'-biphenyl | | Synonyms: | 4,4'-Bis(methoxymethyl)-1,1'-biphenyl in stock Factory;4,4’-Dis(methoxy-methyl)-1,1’-biphenyl;1-(methoxymethyl)-4-[4-(methoxymethyl)phenyl]benzene;4,4-BIS-(METHOXY-MEHTYL) BIPHENYL;,4'-Bis(methoxymethyl)-1,1-biphenyl;4,4'-Di(methoxymethyl)diphenyl;4,4'-Bis(methoxymethyl)-1,1'-biphenyl)biphenyl;1,1'-Biphenyl,4,4'-bis(methoxymethyl)- | | CAS: | 3753-18-2 | | MF: | C16H18O2 | | MW: | 242.31 | | EINECS: | 700-008-0 | | Product Categories: | Biphenyl derivatives;Biphenyl & Diphenyl ether | | Mol File: | 3753-18-2.mol |  |
| | 4,4'-Bis(methoxymethyl)-1,1'-biphenyl Chemical Properties |
| Melting point | 49-50°C | | Boiling point | 350°C | | density | 1.039±0.06 g/cm3(Predicted) | | vapor pressure | 0Pa at 25℃ | | storage temp. | Storage temp. 2-8°C | | solubility | soluble in Toluene | | form | Solid | | color | White to Almost white | | InChI | InChI=1S/C16H18O2/c1-17-11-13-3-7-15(8-4-13)16-9-5-14(6-10-16)12-18-2/h3-10H,11-12H2,1-2H3 | | InChIKey | MODAACUAXYPNJH-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(COC)C=C2)=CC=C(COC)C=C1 | | LogP | 3.15 at 40℃ and pH7 | | Surface tension | 51.5mN/m at 26.4mg/L and 22℃ | | CAS DataBase Reference | 3753-18-2(CAS DataBase Reference) |
| | 4,4'-Bis(methoxymethyl)-1,1'-biphenyl Usage And Synthesis |
| Chemical Properties | White crystalline |
| | 4,4'-Bis(methoxymethyl)-1,1'-biphenyl Preparation Products And Raw materials |
|