| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
|
| | Docetaxel Impurity 4 (Oxazolidine 4S,5S isomer) Basic information |
| Product Name: | Docetaxel Impurity 4 (Oxazolidine 4S,5S isomer) | | Synonyms: | Docetaxel Impurity 4 (Oxazolidine 4S,5S isomer);(4S,5S)-2,2-Dimethyl-4-phenyl-5-oxazolidinedicarboxylic Acid 3-(1,1-Dimethylethyl) Ester Sodium Salt;(4S,5S)-2,2-Dimethyl-4-phenyl-,5-oxazolidinedicarboxylic Acid 3-(1,1-Dimethylethyl) Ester;Docetaxel Impurity 4 (Oxazolidine 4S;Docetaxel Impurity 14 Sodium Salt;DocetaxelImpurity4SodiumSalt;3,5-Oxazolidinedicarboxylic acid, 2,2-dimethyl-4-phenyl-, 3-(1,1-dimethylethyl) ester, (4S,5S)- | | CAS: | 153744-63-9 | | MF: | C17H23NO5 | | MW: | 321.37 | | EINECS: | | | Product Categories: | | | Mol File: | 153744-63-9.mol |  |
| | Docetaxel Impurity 4 (Oxazolidine 4S,5S isomer) Chemical Properties |
| Boiling point | 459.0±45.0 °C(Predicted) | | density | 1.177±0.06 g/cm3(Predicted) | | pka | 3.11±0.60(Predicted) | | InChI | InChI=1S/C17H23NO5/c1-16(2,3)23-15(21)18-12(11-9-7-6-8-10-11)13(14(19)20)22-17(18,4)5/h6-10,12-13H,1-5H3,(H,19,20)/t12-,13-/m0/s1 | | InChIKey | VAHXMEZCPGHDBJ-STQMWFEESA-N | | SMILES | O1[C@H](C(O)=O)[C@H](C2=CC=CC=C2)N(C(OC(C)(C)C)=O)C1(C)C |
| | Docetaxel Impurity 4 (Oxazolidine 4S,5S isomer) Usage And Synthesis |
| Uses | (4S,5S)-2,2-Dimethyl-4-phenyl-,5-oxazolidinedicarboxylic Acid 3-(1,1-Dimethylethyl) Ester is used as a reagent in the synthesis of Docetaxel (D494420); an antineoplastic and antimitotic agent that promotes the assembly of micro-tubules and inhibits their de-polymerization to free tubulin. |
| | Docetaxel Impurity 4 (Oxazolidine 4S,5S isomer) Preparation Products And Raw materials |
|