|
|
| | O-3,4,5-trifluorophenyl carbonochloridothioate Basic information |
| Product Name: | O-3,4,5-trifluorophenyl carbonochloridothioate | | Synonyms: | O-3,4,5-trifluorophenyl carbonochloridothioate;Carbonochloridothioic acid, O-(3,4,5-trifluorophenyl) ester;3,4,5-Trifluorophenylchlorothioformate;O-3,4,5-trifluorophenyl chlorothioformate | | CAS: | 959586-39-1 | | MF: | C7H2ClF3OS | | MW: | 226.6 | | EINECS: | | | Product Categories: | | | Mol File: | 959586-39-1.mol |  |
| | O-3,4,5-trifluorophenyl carbonochloridothioate Chemical Properties |
| Boiling point | 212.4±35.0 °C(Predicted) | | density | 1.590±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C7H2ClF3OS/c8-7(13)12-3-1-4(9)6(11)5(10)2-3/h1-2H | | InChIKey | HWWIYFYGBRJVPG-UHFFFAOYSA-N | | SMILES | C(Cl)(=S)OC1=CC(F)=C(F)C(F)=C1 |
| | O-3,4,5-trifluorophenyl carbonochloridothioate Usage And Synthesis |
| | O-3,4,5-trifluorophenyl carbonochloridothioate Preparation Products And Raw materials |
|