| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
Sulf-DBCO-NHS ester manufacturers
- Sulfo-DBCO-NHS ester
-
-
2025-06-07
- CAS:1379761-19-9
- Min. Order: 50mg
- Purity: >95.00%
- Supply Ability: 250mg
|
| | Sulf-DBCO-NHS ester Basic information |
| Product Name: | Sulf-DBCO-NHS ester | | Synonyms: | Sulf-DBCO-NHS ester;Pentanoic acid, 5-[[3-(11,12-didehydrodibenz[b,f]azocin-5(6H)-yl)-3-oxopropyl](3-sulfopropyl)amino]-5-oxo-, 1-(2,5-dioxo-1-pyrrolidinyl) ester;Sulfo-DBCO-NHS;N-(3-sulfopropyl)-DBCO-N-C3-NHS ester | | CAS: | 1379761-19-9 | | MF: | C30H31N3O9S | | MW: | 609.65 | | EINECS: | | | Product Categories: | | | Mol File: | 1379761-19-9.mol |  |
| | Sulf-DBCO-NHS ester Chemical Properties |
| density | 1.47±0.1 g/cm3(Predicted) | | pka | 1.68±0.50(Predicted) |
| | Sulf-DBCO-NHS ester Usage And Synthesis |
| | Sulf-DBCO-NHS ester Preparation Products And Raw materials |
|