| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | JR-13979, 2-(2-Aminothiazol-4-yl)-4-fluorophenol Basic information |
| | JR-13979, 2-(2-Aminothiazol-4-yl)-4-fluorophenol Chemical Properties |
| Boiling point | 415.6±30.0 °C(Predicted) | | density | 1.476±0.06 g/cm3(Predicted) | | form | solid | | pka | 8.48±0.43(Predicted) | | InChI | 1S/C9H7FN2OS/c10-5-1-2-8(13)6(3-5)7-4-14-9(11)12-7/h1-4,13H,(H2,11,12) | | InChIKey | MVFAUSIPFTWETD-UHFFFAOYSA-N | | SMILES | FC1=CC(C(N2)=CSC2=N)=C(O)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 |
| | JR-13979, 2-(2-Aminothiazol-4-yl)-4-fluorophenol Usage And Synthesis |
| | JR-13979, 2-(2-Aminothiazol-4-yl)-4-fluorophenol Preparation Products And Raw materials |
|