| Company Name: |
Mainchem Co., Ltd.
|
| Tel: |
+86-0592-6210733 |
| Email: |
sale@mainchem.com |
| Products Intro: |
Product Name:SODIUM HEXAFLUOROARSENATE(V)
CAS:12005-86-6
|
|
| | SODIUM HEXAFLUOROARSENATE(V) Basic information |
| | SODIUM HEXAFLUOROARSENATE(V) Chemical Properties |
| density | 3.379 | | form | Powder | | color | white | | Water Solubility | Soluble in water. | | Stability: | Stable. Incompatible with strong oxidizing agents. | | InChI | 1S/AsF6.Na/c2-1(3,4,5,6)7;/q-1;+1 | | InChIKey | NFXMAZFYHDSPPB-UHFFFAOYSA-N | | SMILES | [Na+].F[As-](F)(F)(F)(F)F | | CAS DataBase Reference | 12005-86-6(CAS DataBase Reference) |
| Hazard Codes | T,N | | Risk Statements | 23/25-50/53 | | Safety Statements | 20/21-28-45-60-61 | | RIDADR | 1557 | | WGK Germany | 3 | | RTECS | WB2775000 | | HazardClass | 6.1 | | PackingGroup | II | | HS Code | 28269080 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Acute 1
Aquatic Chronic 1 | | Toxicity | mouse,LD50,intravenous,56mg/kg (56mg/kg),U.S. Army Armament Research & Development Command, Chemical Systems Laboratory, NIOSH Exchange Chemicals. Vol. NX#00127, |
| | SODIUM HEXAFLUOROARSENATE(V) Usage And Synthesis |
| Chemical Properties | solid | | Uses | Sodium hexafluoroarsenate(V) is generally used for pharmaceutical intermediates and chemical research. | | reaction suitability | reagent type: catalyst
core: arsenic | | Safety Profile | Confirmed human carcinogen. Poison by intravenous route. When heated to decomposition it emits very toxic fumes of As, F-, and NazO. See also FLUORIDES and ARSENIC COMPOUNDS. |
| | SODIUM HEXAFLUOROARSENATE(V) Preparation Products And Raw materials |
|