- SR 12813
-
- $2.00
-
2026-07-02
- CAS:126411-39-0
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | SR 12813 Basic information |
| Product Name: | SR 12813 | | Synonyms: | SR-12813(GW 485801);SR-12813;SR12813;SR 12813;GW 485801;GW-485801;GW485801;GW 485801;GW485801;GW-485801;[[3,5-Bis(1,1-dimethylethyl)-4-hydroxyphenyl]ethenylidene]bis-phosphonicacidtetraethylester;SR12813;SR 12813;Phosphonic acid, P,P'-[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]ethenylidene]bis-, P,P,P',P'-tetraethyl ester | | CAS: | 126411-39-0 | | MF: | C24H42O7P2 | | MW: | 504.53 | | EINECS: | | | Product Categories: | | | Mol File: | 126411-39-0.mol |  |
| | SR 12813 Chemical Properties |
| Melting point | 119-121℃ | | Boiling point | 552.6±50.0 °C(Predicted) | | density | 1.117±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO: ≥10 mg/mL | | form | solid | | pka | 9.95±0.70(Predicted) | | color | White to off-white | | biological source | synthetic (organic) | | InChI | 1S/C24H42O7P2/c1-11-28-32(26,29-12-2)21(33(27,30-13-3)31-14-4)17-18-15-19(23(5,6)7)22(25)20(16-18)24(8,9)10/h15-17,25H,11-14H2,1-10H3 | | InChIKey | YQLJDECYQDRSBI-UHFFFAOYSA-N | | SMILES | CCOP(=O)(OCC)C(=C/c1cc(c(O)c(c1)C(C)(C)C)C(C)(C)C)\P(=O)(OCC)OCC |
| WGK Germany | 3 | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids |
| | SR 12813 Usage And Synthesis |
| Uses | SR 12813 is a pregnane X receptor (PXR, NR 112) agonist. | | Definition | ChEBI: An organic phosphonate that is the tetraethyl ester of [2-(3,5-di-tert-butyl-4-hydroxyphenyl)ethene-1,1-diyl]bis(phosphonic acid). | | Biological Activity | Pregnane X receptor (PXR) agonist (EC 50 values are 200 and 700 nM for human and rabbit PXR respectively). Activates the farnesoid X receptor (FXR) at μ M concentrations. Displays hypocholesterolaemic activity via enchanced degradation of HMG-CoA reductase. | | Biochem/physiol Actions | SR-12813 is a 1,1-bisphosphonate ester that exhibits hypocholesterolemic activity. It decreases the biosynthesis of cholesterol by enhancing the degradation of HMG-CoA reductase. | | storage | Store at +4°C |
| | SR 12813 Preparation Products And Raw materials |
|