| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | N N-dimethyl-4-[(trimethylsilyl)ethynyl& Basic information |
| | N N-dimethyl-4-[(trimethylsilyl)ethynyl& Chemical Properties |
| Melting point | 86-90 °C(lit.) | | Boiling point | 274.7±32.0 °C(Predicted) | | density | 0.94±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 5.75±0.24(Predicted) | | InChI | 1S/C13H19NSi/c1-14(2)13-8-6-12(7-9-13)10-11-15(3,4)5/h6-9H,1-5H3 | | InChIKey | CTEFXFPTVUQSHR-UHFFFAOYSA-N | | SMILES | CN(C)c1ccc(cc1)C#C[Si](C)(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | N N-dimethyl-4-[(trimethylsilyl)ethynyl& Usage And Synthesis |
| | N N-dimethyl-4-[(trimethylsilyl)ethynyl& Preparation Products And Raw materials |
|