| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3'-Acetylamino-4'-methoxyacetophenone Basic information |
| | 3'-Acetylamino-4'-methoxyacetophenone Chemical Properties |
| Melting point | 120-124 °C (lit.) | | form | solid | | InChI | 1S/C11H13NO3/c1-7(13)9-4-5-11(15-3)10(6-9)12-8(2)14/h4-6H,1-3H3,(H,12,14) | | InChIKey | YAWSGLTYMVPIRM-UHFFFAOYSA-N | | SMILES | COc1ccc(cc1NC(C)=O)C(C)=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3'-Acetylamino-4'-methoxyacetophenone Usage And Synthesis |
| | 3'-Acetylamino-4'-methoxyacetophenone Preparation Products And Raw materials |
|