1-METHYLINDOLE-2-CARBOXALDEHYDE 97 manufacturers
|
| | 1-METHYLINDOLE-2-CARBOXALDEHYDE 97 Basic information |
| | 1-METHYLINDOLE-2-CARBOXALDEHYDE 97 Chemical Properties |
| Melting point | 81-85 °C (lit.) | | Boiling point | 90-95 °C(Press: 0.02 Torr) | | density | 1.10±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C10H9NO/c1-11-9(7-12)6-8-4-2-3-5-10(8)11/h2-7H,1H3 | | InChIKey | IBNGPIOSWCMJGG-UHFFFAOYSA-N | | SMILES | N1(C)C2=C(C=CC=C2)C=C1C=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-METHYLINDOLE-2-CARBOXALDEHYDE 97 Usage And Synthesis |
| Uses | Reactant for preparation of:
- Deazapurine isosteres from acylindoles via pyridine ring annulation
- 2,4-dichlorocinnamohydroxamic acid analogs for enhancing pharmacokinetics of botulinum neurotoxin serotype A protease inhibitors
- Tetrahydrocarbazoles via organocatalytic cascade Friedel-Crafts alkylation/Michael addition/aromatization reaction
- Azides, imines and amines via flow processes of amines and trimethylsilyl azide and aza-Wittig reaction
- 3-indolylpyridinedicarbonitriles as anti-inflammatory agents
- Bis(indolyl)methanes as antimicrobial and antioxidant agents
|
| | 1-METHYLINDOLE-2-CARBOXALDEHYDE 97 Preparation Products And Raw materials |
|