- (S)-TBS-glycidol ether
-
- $0.00 / 25kg
-
2025-12-01
- CAS:123237-62-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kgs
|
| | TERT-BUTYLDIMETHYLSILYL (S)-(-)-GLYCIDY& Basic information |
| | TERT-BUTYLDIMETHYLSILYL (S)-(-)-GLYCIDY& Chemical Properties |
| Boiling point | 197-199 °C/760 mmHg | | density | 0.890 g/mL at 25 °C | | refractive index | n20/D 1.431(lit.) | | Fp | 165 °F | | storage temp. | 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 0.87 | | Optical Rotation | [α]22/D +6.5°, neat | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | 1S/C9H20O2Si/c1-9(2,3)12(4,5)11-7-8-6-10-8/h8H,6-7H2,1-5H3/t8-/m0/s1 | | InChIKey | YANSSVVGZPNSKD-QMMMGPOBSA-N | | SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CO1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | RIDADR | UN 1993 / PGIII | | WGK Germany | 3 | | TSCA | No | | HS Code | 29319090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral |
| | TERT-BUTYLDIMETHYLSILYL (S)-(-)-GLYCIDY& Usage And Synthesis |
| Uses | tert-Butyldimethylsilyl (S)-(+)-Glycidyl Ether is a glycidol derivative involved in the preparation of tetrahydroquinoline-based tricyclic amines as orally-active, selective and very potent agonists of the 5-hydrogen carbide tritide receptor. |
| | TERT-BUTYLDIMETHYLSILYL (S)-(-)-GLYCIDY& Preparation Products And Raw materials |
|