| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
trans-1-Propen-1-ylboronic acid manufacturers
|
| | trans-1-Propen-1-ylboronic acid Basic information |
| | trans-1-Propen-1-ylboronic acid Chemical Properties |
| Melting point | 123-127 °C(lit.) | | Boiling point | 175.6±23.0 °C(Predicted) | | density | 0.972 g/cm3(Temp: 19 °C) | | storage temp. | 2-8°C | | solubility | Chloroform (Very Slightly, Heated), Methanol (Very Slightly) | | form | Solid | | pka | 9.80±0.43(Predicted) | | color | Pale Beige | | InChI | InChI=1S/C3H7BO2/c1-2-3-4(5)6/h2-3,5-6H,1H3/b3-2+ | | InChIKey | CBMCZKMIOZYAHS-NSCUHMNNSA-N | | SMILES | C(=C/C)\B(O)O |
| WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | trans-1-Propen-1-ylboronic acid Usage And Synthesis |
| Uses | Reactant for:
- Palladium-phosphine-catalyzed Suzuki-Miyaura coupling reactions
- Cu(II)-mediated Ullmann-type coupling
Reactant for preparation of:
- Alkynylphenoxyacetic acids as DP2 receptor antagonists for treatment of allergic inflammatory diseases
- Tetrahydrobenzothiophenes as conformationally restricted enol-mimic inhibitors of type II dehydroquinase via Paal-Knorr synthesis involving Suzuki coupling
- Highly substituted benzannulated cyclooctanol derivatives by samarium diiodide-mediated cyclization
- Stereospecific dienes via nickel-catalyzed three-component reductive coupling with alkynes and enones
|
| | trans-1-Propen-1-ylboronic acid Preparation Products And Raw materials |
|