WITHANOLIDE A(P) manufacturers
- WITHANOLIDE A(P)
-
-
2026-05-29
- CAS:32911-62-9
- Min. Order:
- Purity: 0.99
- Supply Ability:
- Withanolide A
-
- $89.00 / 1mg
-
2026-05-26
- CAS:32911-62-9
- Min. Order:
- Purity: 99.50%
- Supply Ability: 10g
- WITHANOLIDE A(P)
-
- $1.00 / 1KG
-
2024-08-13
- CAS:32911-62-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
|
| | WITHANOLIDE A(P) Basic information |
| Product Name: | WITHANOLIDE A(P) | | Synonyms: | Withanolide A 32911-62-9;WITHANOLIDE A(P);(20R,22R)-5α,20-Dihydroxy-6α,7α:22,26-diepoxyergosta-2,24-diene-1,26-dione;(22R)-1-Oxo-5,20,22-trihydroxy-6α,7α-epoxy-5α-ergosta-2,24-diene-26-oic acid δ-lactone;(22R)-6α,7α-Epoxy-5,20,22-trihydroxy-1-oxo-5α-ergosta-2,24-dien-26-oic acid δ-lactone;WITHANOLIDE A(SH);5,20alpha-Dihydroxy-6alpha,7alpha-epoxy-1-oxowitha-2,24-dienolide;Withaniol | | CAS: | 32911-62-9 | | MF: | C28H38O6 | | MW: | 470.6 | | EINECS: | 628-471-3 | | Product Categories: | | | Mol File: | 32911-62-9.mol |  |
| | WITHANOLIDE A(P) Chemical Properties |
| Melting point | 305℃ (DEC.) | | Boiling point | 651.6±55.0 °C(Predicted) | | density | 1.264 | | storage temp. | -20°C | | solubility | methanol: soluble1mg/mL, clear, colorless | | form | powder | | pka | 13.05±0.70(Predicted) | | color | white | | Major Application | food and beverages | | InChIKey | DXWHOKCXBGLTMQ-OCNHUHSRNA-N | | SMILES | CC1=C(C)C(=O)O[C@H](C1)[C@](C)(O)[C@H]2CC[C@H]3[C@H]4[C@H](CC[C@]23C)[C@@]5(C)C(=O)C=CC[C@]5(O)[C@H]6O[C@@H]46 |
| WGK Germany | 3 | | HS Code | 2932206000 | | Storage Class | 11 - Combustible Solids |
| | WITHANOLIDE A(P) Usage And Synthesis |
| Uses | Withanolide A, is a neuritogenic steroid. It may act as deterrent for feeding insect larva and other herbivores. Withaferin A, causes activation of Notch2 and Notch4 in human breast cancer cells, and thus used as novel anticancer agents. | | Definition | ChEBI: Withanolide A is a withanolide. | | Biological Activity | C28-steroidal lactone th at can induce nerve development and improve nervous system function. Potential therapeutic for neurologic disorders like Alzheimer′s and Parkinson′s disease. In primary r at cortical neurons, withanolide A significantly up-regulated IDE levels, a prominent enzyme involved in degrading amyloid β protein, which may help to clear excess amyloid β protein from an Alzheimerμs-inflicted brain. |
| | WITHANOLIDE A(P) Preparation Products And Raw materials |
|