| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2,6-Bis(chloromethyl)-4-methylphenol, 97 Basic information |
| | 2,6-Bis(chloromethyl)-4-methylphenol, 97 Chemical Properties |
| Melting point | 76-83 °C | | Boiling point | 314.4±37.0 °C(Predicted) | | density | 1.285±0.06 g/cm3(Predicted) | | pka | 9.04±0.50(Predicted) | | InChI | InChI=1S/C9H10Cl2O/c1-6-2-7(4-10)9(12)8(3-6)5-11/h2-3,12H,4-5H2,1H3 | | InChIKey | NUSAOAJCGJSAIU-UHFFFAOYSA-N | | SMILES | C1(O)=C(CCl)C=C(C)C=C1CCl |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | UN 3335 | | WGK Germany | 3 | | RTECS | OX6600000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 2,6-Bis(chloromethyl)-4-methylphenol, 97 Usage And Synthesis |
| | 2,6-Bis(chloromethyl)-4-methylphenol, 97 Preparation Products And Raw materials |
|