| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | N-(4-Pentynyl)phthalimide 97 Basic information |
| | N-(4-Pentynyl)phthalimide 97 Chemical Properties |
| Melting point | 87-91 °C (lit.) | | Boiling point | 339.7±25.0 °C(Predicted) | | density | 1.229±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | -2.18±0.20(Predicted) | | form | solid | | Appearance | White to light yellow Solid | | InChI | 1S/C13H11NO2/c1-2-3-6-9-14-12(15)10-7-4-5-8-11(10)13(14)16/h1,4-5,7-8H,3,6,9H2 | | InChIKey | YNZIPXLLPFYDGM-UHFFFAOYSA-N | | SMILES | O=C1N(CCCC#C)C(=O)c2ccccc12 |
| Hazard Codes | Xi | | Risk Statements | 36-43 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HS Code | 29251995 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Sens. 1 |
| | N-(4-Pentynyl)phthalimide 97 Usage And Synthesis |
| Chemical Properties | White to slightly yellow crystalline powder | | Uses | N-(4-Pentynyl)phthalimide is used as pharmaceutical intermediate. |
| | N-(4-Pentynyl)phthalimide 97 Preparation Products And Raw materials |
|