| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | N-Benzyl-1H-benzotriazole-1-carbothioam& Basic information |
| Product Name: | N-Benzyl-1H-benzotriazole-1-carbothioam& | | Synonyms: | Benzotriazole-1-carbothioic acid benzylamide, N-(Phenylmethyl)-1H-benzotriazole-1-carbothioamide;1H-Benzotriazole-1-carbothioamide, N-(phenylmethyl)-;N-Benzyl-1H-benzotriazole-1-carbothioamide;N-Benzyl-1H-benzotriazole-1-carbothioam& | | CAS: | 690634-11-8 | | MF: | C14H12N4S | | MW: | 268.34 | | EINECS: | | | Product Categories: | | | Mol File: | 690634-11-8.mol |  |
| | N-Benzyl-1H-benzotriazole-1-carbothioam& Chemical Properties |
| Melting point | 112-116 °C(lit.) | | Boiling point | 451.9±38.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 10.44±0.70(Predicted) | | form | solid | | InChI | 1S/C14H12N4S/c19-14(15-10-11-6-2-1-3-7-11)18-13-9-5-4-8-12(13)16-17-18/h1-9H,10H2,(H,15,19) | | InChIKey | ANAZVFTXAPJJLT-UHFFFAOYSA-N | | SMILES | S=C(NCc1ccccc1)n2nnc3ccccc23 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | N-Benzyl-1H-benzotriazole-1-carbothioam& Usage And Synthesis |
| Uses | New Benzotriazole Reagents
Used as:
- Corrosion inhibitor during copper corrosion in acid solutions
Reactant for:
- C-thiocarbamoylation reactions
- Condensation reactions
- Preparation of diversely substituted thiosemicarbazides and N-hydroxythioureas via substitution reaction with hydrazines or hydroxylamines
- Guanylation of diverse amines
| | reaction suitability | reaction type: C-C Bond Formation |
| | N-Benzyl-1H-benzotriazole-1-carbothioam& Preparation Products And Raw materials |
|