2,2,3,3-TETRAMETHYLSUCCINIC ACID, 97 manufacturers
|
| | 2,2,3,3-TETRAMETHYLSUCCINIC ACID, 97 Basic information |
| Product Name: | 2,2,3,3-TETRAMETHYLSUCCINIC ACID, 97 | | Synonyms: | 2,2,3,3-TETRAMETHYLSUCCINIC ACID, 97;2,3-Butanedicarboxylic acid, 2,3-dimethyl-;Butanedioic acid, tetramethyl-;butanedioicacid,tetramethyl-;Succinic acid, tetramethyl-;succinicacid,tetramethyl-;tetramethylbutanedioicacid;Tetramethylsuccinic acid | | CAS: | 630-51-3 | | MF: | C8H14O4 | | MW: | 174.19 | | EINECS: | | | Product Categories: | | | Mol File: | 630-51-3.mol |  |
| | 2,2,3,3-TETRAMETHYLSUCCINIC ACID, 97 Chemical Properties |
| Melting point | 204-206 | | Boiling point | 345.17°C (rough estimate) | | density | 1.3000 | | refractive index | 1.4338 (estimate) | | Fp | 125.1oC | | storage temp. | 2-8°C | | pka | pK1:3.50;pK2:7.28 (25°C) | | form | powder | | color | White | | Water Solubility | 4.8g/L(13.5 ºC) | | InChI | InChI=1S/C8H14O4/c1-7(2,5(9)10)8(3,4)6(11)12/h1-4H3,(H,9,10)(H,11,12) | | InChIKey | CDPPYCZVWYZBJH-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(C)(C)C(C)(C)C(O)=O |
| Hazard Note | Irritant | | HS Code | 2917198090 |
| | 2,2,3,3-TETRAMETHYLSUCCINIC ACID, 97 Usage And Synthesis |
| Uses | Tetramethylsuccinic Acid can be useful in the synthesis of nitroalkyls and nitroarenes. | | Description | 2,2,3,3-Tetramethylsuccinic acid is an organic acid compound that is a product of the interaction of lithium acrylate α-carbon ions with 1,2-dibromoalkanes, and is mainly used in chemical materials and experimental research[1]. | | References | [1] ZORIN A, CHANYSHEVA A R, LENKOVA A O, et al. INTERACTION OF α-CARBANIONS OF LITHIUM ACYLATES WITH 1,2-DIBROMOALKANES[C]. 2020. DOI:10.6060/ivkkt.20206304.6150. |
| | 2,2,3,3-TETRAMETHYLSUCCINIC ACID, 97 Preparation Products And Raw materials |
|