(S)-5,7-difluorochroman-4-ol manufacturers
- (S)-5,7-difluorochroman-4-ol
-
- $35.00 / 1kg
-
2025-09-25
- CAS:942195-91-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | (S)-5,7-difluorochroman-4-ol Basic information |
| Product Name: | (S)-5,7-difluorochroman-4-ol | | Synonyms: | (S)-5,7-difluorochroman-4-ol;(4S)-5,7-DIFLUORO-3,4-DIHYDRO-2H-1-BENZOPYRAN-4-OL;2H-1-Benzopyran-4-ol, 5,7-difluoro-3,4-dihydro-, (4S)-;Tegoprazan Impurity 12;(S)-5,7-difluorochroman-4-o;Tegoprazan Impurities22;Tegopnasam internediate;Tigora produces impurity 12 | | CAS: | 942195-91-7 | | MF: | C9H8F2O2 | | MW: | 186.16 | | EINECS: | | | Product Categories: | | | Mol File: | 942195-91-7.mol |  |
| | (S)-5,7-difluorochroman-4-ol Chemical Properties |
| Boiling point | 228.4±40.0 °C(Predicted) | | density | 1.402±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 13.09±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H8F2O2/c10-5-3-6(11)9-7(12)1-2-13-8(9)4-5/h3-4,7,12H,1-2H2/t7-/m0/s1 | | InChIKey | HGTYMLFMXKYIQW-ZETCQYMHSA-N | | SMILES | C1OC2=CC(F)=CC(F)=C2[C@@H](O)C1 |
| | (S)-5,7-difluorochroman-4-ol Usage And Synthesis |
| Uses | (S)-5,7-difluorochroman-4-ol is an intermediate of Tegoprazan, a medicine that treats gastroesophageal reflux disease and erosive esophagitis. |
| | (S)-5,7-difluorochroman-4-ol Preparation Products And Raw materials |
|