|
|
| | Benzoic acid, 4-(6-methyl-1,2,4,5-tetrazin-3-yl)- Basic information |
| Product Name: | Benzoic acid, 4-(6-methyl-1,2,4,5-tetrazin-3-yl)- | | Synonyms: | Benzoic acid, 4-(6-methyl-1,2,4,5-tetrazin-3-yl)-;4-(6-methyl-1,2,4,5-tetrazine-3-yl)benzoic acid;4-(6-methyl-1,2,4,5-tetrazine-3-yl)benzenemacetic acid;4-(6-methyl-1,2,4,5-tetrazin-3-yl)benzoic acid | | CAS: | 1345866-66-1 | | MF: | C10H8N4O2 | | MW: | 216.2 | | EINECS: | | | Product Categories: | | | Mol File: | 1345866-66-1.mol |  |
| | Benzoic acid, 4-(6-methyl-1,2,4,5-tetrazin-3-yl)- Chemical Properties |
| Boiling point | 483.2±47.0 °C(Predicted) | | density | 1.382±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 3.06±0.10(Predicted) | | Appearance | Purple to purplish red Solid | | InChI | InChI=1S/C10H8N4O2/c1-6-11-13-9(14-12-6)7-2-4-8(5-3-7)10(15)16/h2-5H,1H3,(H,15,16) | | InChIKey | VIRCHPVFFZGAJH-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(C2=NN=C(C)N=N2)C=C1 |
| | Benzoic acid, 4-(6-methyl-1,2,4,5-tetrazin-3-yl)- Usage And Synthesis |
| | Benzoic acid, 4-(6-methyl-1,2,4,5-tetrazin-3-yl)- Preparation Products And Raw materials |
|