|
|
| | STAT3 Inhibitor IX, Cpd188 - CAS 823828-18-8 - Calbiochem Basic information |
| | STAT3 Inhibitor IX, Cpd188 - CAS 823828-18-8 - Calbiochem Chemical Properties |
| Boiling point | 718.2±70.0 °C(Predicted) | | density | 1.67±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 100mg/mL | | pka | 2.40±0.30(Predicted) | | form | Solid | | color | Off-white to light yellow | | InChI | 1S/C19H15NO7S2/c21-17(22)10-28-16-9-15(13-3-1-2-4-14(13)18(16)23)20-29(26,27)12-7-5-11(6-8-12)19(24)25/h1-9,20,23H,10H2,(H,21,22)(H,24,25) | | InChIKey | CIERPRDYPKVDJO-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)(Nc2c3c(c(c(c2)SCC(=O)O)O)cccc3)c1ccc(cc1)C(=O)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | STAT3 Inhibitor IX, Cpd188 - CAS 823828-18-8 - Calbiochem Usage And Synthesis |
| Uses | C188 is a STAT3 inhibitor that inhibits IL-6-stimulated STAT3 phosphorylation and nuclear translocation in HepG2 cells by targeting STAT3 SH2 domain peptide-binding pocket. C188, in particular, was highly active in inducing apoptosis of the breast cancer cell line MB-MDA-468 in vitro (EC50= 0.7 μM). | | References | [1] Xu X, Kasembeli MM, Jiang X, Tweardy BJ, Tweardy DJ. Chemical probes that competitively and selectively inhibit Stat3 activation. PLoS One. 2009;4(3):e4783. DOI:10.1371/journal.pone.0004783 |
| | STAT3 Inhibitor IX, Cpd188 - CAS 823828-18-8 - Calbiochem Preparation Products And Raw materials |
|