| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | L-Proline-13C5 Basic information |
| Product Name: | L-Proline-13C5 | | Synonyms: | L-Proline-13C5 99 atom % 13C, 99% (CP);L-Proline-13C?;L-Proline-carboxy,2,3,4,5-13C5;L-Proline-13C5;L-Proline (13C?, 99%);L-Proline-[13C5] | | CAS: | 201740-83-2 | | MF: | C5H9NO2 | | MW: | 120.09 | | EINECS: | | | Product Categories: | | | Mol File: | 201740-83-2.mol |  |
| | L-Proline-13C5 Chemical Properties |
| Melting point | 228 °C (dec.) (lit.) | | density | 1.187±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Store at -20°C | | form | Solid | | color | White to off-white | | Optical Rotation | [α]25/D -86.0°, c =2 in H2O | | Water Solubility | Water : 250 mg/mL (2081.77 mM; Need ultrasonic) | | InChI | 1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1/i1+1,2+1,3+1,4+1,5+1 | | InChIKey | ONIBWKKTOPOVIA-JRGPAWSWSA-N | | SMILES | O[13C](=O)[13C@@H]1[13CH2][13CH2][13CH2]N1 | | CAS Number Unlabeled | 147-85-3 |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | L-Proline-13C5 Usage And Synthesis |
| Uses | L-Proline-13C5 is the labeled analogue of L-Proline (P755995) which is an amino acid and precursor (with vitamin C) for collagen, the building block of the structure of tendons, ligaments, arteries, veins and muscles. It is aksi important in wound healing. | | Definition | ChEBI: Proline_13C5 is a proline derivative. |
| | L-Proline-13C5 Preparation Products And Raw materials |
|