|
|
| | 3-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic Acid Basic information |
| Product Name: | 3-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic Acid | | Synonyms: | 3-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic Acid;2-Naphthalenecarboxylic acid, 5,6,7,8-tetrahydro-3-hydroxy- | | CAS: | 25435-10-3 | | MF: | C11H12O3 | | MW: | 192.21 | | EINECS: | | | Product Categories: | | | Mol File: | 25435-10-3.mol |  |
| | 3-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic Acid Chemical Properties |
| Melting point | 180-182 °C | | Boiling point | 170-180 °C(Press: 0.4 Torr) | | density | 1.305±0.06 g/cm3(Predicted) | | pka | 3.34±0.20(Predicted) | | form | solid | | InChI | 1S/C11H12O3/c12-10-6-8-4-2-1-3-7(8)5-9(10)11(13)14/h5-6,12H,1-4H2,(H,13,14) | | InChIKey | WFOLEQGOHRSJHA-UHFFFAOYSA-N | | SMILES | OC(C1=CC2=C(C=C1O)CCCC2)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic Acid Usage And Synthesis |
| | 3-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxylic Acid Preparation Products And Raw materials |
|