| Company Name: |
Shanghai Devinchem Ltd Gold
|
| Tel: |
027-65318838 13646286950 |
| Email: |
sales@devinchem.com |
| Products Intro: |
Product Name:4-Methoxy-5-fluoro-1H-indole CAS:1227512-37-9 Purity:97% Package:1g;5g;10g Remarks:CL4986
|
| Company Name: |
Shanghai Jieshikai Biotechnology Co. , Ltd.
|
| Tel: |
021-57520305 13795461237 |
| Email: |
zhuruyan@jskchem.com |
| Products Intro: |
Product Name:5-Fluoro-4-methoxy-1H-indole CAS:1227512-37-9 Purity:95% Package:100mg;250mg;1g
|
|
| | 1H-Indole, 5-fluoro-4-methoxy- Basic information |
| | 1H-Indole, 5-fluoro-4-methoxy- Chemical Properties |
| InChI | InChI=1S/C9H8FNO/c1-12-9-6-4-5-11-8(6)3-2-7(9)10/h2-5,11H,1H3 | | InChIKey | RQYJVASDDMWUNI-UHFFFAOYSA-N | | SMILES | N1C2=C(C(OC)=C(F)C=C2)C=C1 |
| | 1H-Indole, 5-fluoro-4-methoxy- Usage And Synthesis |
| | 1H-Indole, 5-fluoro-4-methoxy- Preparation Products And Raw materials |
|