|
|
| | 4,6-DIMETHOXYSALICYLALDEHYDE Basic information |
| Product Name: | 4,6-DIMETHOXYSALICYLALDEHYDE | | Synonyms: | LABOTEST-BB LT00233212;4,6-DIMETHOXYSALICYLALDEHYDE;4,6-DIMETHOXY-2-HYDROXYBENZALDEHYDE;2,4-DIMETHOXY-6-HYDROXYBENZALDEHYDE;2-HYDROXY-4,6-DIMETHOXYBENZALDEHYDE;4,6-Dimethoxy-2-hydroxybenzaldehyde 98%;4,6-DIMETHOXYSALICYLALDEHYDE (4,6-DIMETHOXY-2-HYDROXYBENZALDEHYDE);2,4-Dimethoxy-6-hydroxybenzaldehyde, 4,6-Dimethoxy-2-hydroxybenzaldehyde | | CAS: | 708-76-9 | | MF: | C9H10O4 | | MW: | 182.17 | | EINECS: | 211-904-1 | | Product Categories: | Benzaldehyde;Aldehydes;blocks;Aromatic Aldehydes & Derivatives (substituted) | | Mol File: | 708-76-9.mol |  |
| | 4,6-DIMETHOXYSALICYLALDEHYDE Chemical Properties |
| Melting point | 68-70 °C (lit.) | | Boiling point | 131°C/0.05mmHg(lit.) | | density | 1.2481 (rough estimate) | | refractive index | 1.4500 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 7.42±0.15(Predicted) | | color | White to Light yellow to Light orange | | BRN | 1241679 | | InChI | InChI=1S/C9H10O4/c1-12-6-3-8(11)7(5-10)9(4-6)13-2/h3-5,11H,1-2H3 | | InChIKey | FQRQWPNYJOFDLO-UHFFFAOYSA-N | | SMILES | C(=O)C1=C(OC)C=C(OC)C=C1O | | CAS DataBase Reference | 708-76-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-36/37 | | WGK Germany | 3 | | F | 9-23 | | Hazard Note | Harmful/Store Cold | | HS Code | 2912490090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4,6-DIMETHOXYSALICYLALDEHYDE Usage And Synthesis |
| Chemical Properties | yellow to beige crystalline powder | | Uses | 4,6-Dimethoxysalicylaldehyde was used in the preparation of a new class of efficient ketocoumarin triplet sensitizers. It was used as staring reagent in the total synthesis of (+/-)-linderol A, a hexahydrodibenzofuran. | | General Description | 4,6-Dimethoxysalicylaldehyde on condensation with methylamine yields Schiff bases. | | Biochem/physiol Actions | 4,6-Dimethoxysalicylaldehyde has antimicrobial activity against Candida albicans. |
| | 4,6-DIMETHOXYSALICYLALDEHYDE Preparation Products And Raw materials |
|