4-Amino-2-fluoropyridine manufacturers
- 4-Amino-2-fluoropyridine
-
- $1.10 / 1g
-
2025-06-25
- CAS:18614-51-2
- Min. Order: 1g
- Purity: 99.0% min
- Supply Ability: 100 tons min
|
| | 4-Amino-2-fluoropyridine Basic information |
| | 4-Amino-2-fluoropyridine Chemical Properties |
| Melting point | 83-88°C | | Boiling point | 264.0±20.0 °C(Predicted) | | density | 1.257±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 3.76±0.30(Predicted) | | color | Pale yellow | | InChI | InChI=1S/C5H5FN2/c6-5-3-4(7)1-2-8-5/h1-3H,(H2,7,8) | | InChIKey | JSAKBYXSHKYFQU-UHFFFAOYSA-N | | SMILES | C1(F)=NC=CC(N)=C1 | | CAS DataBase Reference | 18614-51-2(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Amino-2-fluoropyridine Usage And Synthesis |
| Uses | 4-Amino-2-fluoropyridine is a useful synthesis intermediate. |
| | 4-Amino-2-fluoropyridine Preparation Products And Raw materials |
|