|
|
| | (S)-(-)-Tetrahydro-2-furoic acid Basic information | | Uses |
| | (S)-(-)-Tetrahydro-2-furoic acid Chemical Properties |
| alpha | -3 º (in MeOH) | | Boiling point | 244-251 °C(lit.) | | density | 1.2 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.459(lit.) | | Fp | 230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid | | pka | 3.60±0.20(Predicted) | | color | Clear colorless to pale yellow | | Optical Rotation | [α]20/D 3° in methanol | | BRN | 4658738 | | InChI | InChI=1S/C5H8O3/c6-5(7)4-2-1-3-8-4/h4H,1-3H2,(H,6,7)/t4-/m0/s1 | | InChIKey | UJJLJRQIPMGXEZ-BYPYZUCNSA-N | | SMILES | O1CCC[C@H]1C(O)=O | | CAS DataBase Reference | 87392-07-2(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 22-34-36/37/38 | | Safety Statements | 26-36/37/39-45-36 | | RIDADR | UN 3265 8/PG 3 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29321900 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |
| | (S)-(-)-Tetrahydro-2-furoic acid Usage And Synthesis |
| Uses | (S)-Tetrahydrofuran-2-carboxylic acid is used in organic synthesis and can be applied in laboratory research and development processes as well as in chemical and pharmaceutical synthesis. | | Chemical Properties | Colorless to light yellow liqui |
| | (S)-(-)-Tetrahydro-2-furoic acid Preparation Products And Raw materials |
|