|
| (S)-(-)-Tetrahydro-2-furoic acid Basic information |
| (S)-(-)-Tetrahydro-2-furoic acid Chemical Properties |
alpha | -3 º (in MeOH) | Boiling point | 244-251 °C(lit.) | density | 1.2 g/mL at 25 °C(lit.) | refractive index | n20/D 1.459(lit.) | Fp | 230 °F | storage temp. | Sealed in dry,Room Temperature | form | Liquid | pka | 3.60±0.20(Predicted) | color | Clear colorless to pale yellow | Optical Rotation | [α]20/D 3° in methanol | BRN | 4658738 | InChI | InChI=1S/C5H8O3/c6-5(7)4-2-1-3-8-4/h4H,1-3H2,(H,6,7)/t4-/m0/s1 | InChIKey | UJJLJRQIPMGXEZ-BYPYZUCNSA-N | SMILES | O1CCC[C@H]1C(O)=O | CAS DataBase Reference | 87392-07-2(CAS DataBase Reference) |
| (S)-(-)-Tetrahydro-2-furoic acid Usage And Synthesis |
Chemical Properties | Colorless to light yellow liqui |
| (S)-(-)-Tetrahydro-2-furoic acid Preparation Products And Raw materials |
|