|
|
| | 4-(4-Methylpiperazino)aniline Basic information |
| | 4-(4-Methylpiperazino)aniline Chemical Properties |
| Melting point | 89 °C | | Boiling point | 180°C/5mmHg(lit.) | | density | 1.092±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | DMSO (Sparingly), Methanol (Slightly) | | form | Solid | | pka | 8.08±0.42(Predicted) | | color | Very Dark Gray to Black | | Sensitive | Air Sensitive | | InChI | InChI=1S/C11H17N3/c1-13-6-8-14(9-7-13)11-4-2-10(12)3-5-11/h2-5H,6-9,12H2,1H3 | | InChIKey | MOZNZNKHRXRLLF-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(N2CCN(C)CC2)C=C1 | | CAS DataBase Reference | 16153-81-4(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 3259 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29349990 |
| | 4-(4-Methylpiperazino)aniline Usage And Synthesis |
| Chemical Properties | Purple solid | | Uses | 4-(4-Methylpiperazino)aniline is a reagent in the preparation of benzyloxypyridinone derivative which has c-Met kinase inhibitor properties. | | Synthesis | GENERAL METHOD: 1-methyl-4-(4-nitrophenyl)piperazine (5.53 mmol) was dissolved in methanol (15 mL) and stirred under N2 atmosphere. Pd/C (2.78 mmol) was added to this solution. Subsequently, the reaction flask was placed in H2 atmosphere (balloon) for hydrogenation reaction overnight. Upon completion of the reaction, the reaction mixture was filtered through a diatomaceous earth plate and the filtrate was concentrated under vacuum. The crude product was purified by silica gel column chromatography (eluent: 5% MeOH/DCM containing 1% NH3) to afford the target compound 4-(4-methyl-1-piperazinyl)aniline (3a) as a brown solid in 87% yield. | | References | [1] Journal of Medicinal Chemistry, 2005, vol. 48, # 26, p. 8261 - 8269
[2] European Journal of Medicinal Chemistry, 2016, vol. 124, p. 896 - 905
[3] Patent: US6569878, 2003, B1
[4] Patent: EP1215208, 2002, A2. Location in patent: Example C(70)
[5] Patent: WO2012/110773, 2012, A1. Location in patent: Page/Page column 58; 59 |
| | 4-(4-Methylpiperazino)aniline Preparation Products And Raw materials |
|