1-(2,3-Xylyl)piperazine monohydrochloride manufacturers
|
| | 1-(2,3-Xylyl)piperazine monohydrochloride Basic information |
| | 1-(2,3-Xylyl)piperazine monohydrochloride Chemical Properties |
| Melting point | >300 °C(lit.) | | Boiling point | 95-97°C 0,2mm | | density | 0.9306 (rough estimate) | | refractive index | 1.5600 (estimate) | | form | powder | | InChI | 1S/C12H18N2.ClH/c1-10-4-3-5-12(11(10)2)14-8-6-13-7-9-14;/h3-5,13H,6-9H2,1-2H3;1H | | InChIKey | SHOLVQVIKRVCGQ-UHFFFAOYSA-N | | SMILES | Cl[H].Cc1cccc(N2CCNCC2)c1C | | CAS DataBase Reference | 80836-96-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-(2,3-Xylyl)piperazine monohydrochloride Usage And Synthesis |
| Uses | 1-(2,3-Xylyl)piperazine monohydrochloride may be used in chemical synthesis studies. |
| | 1-(2,3-Xylyl)piperazine monohydrochloride Preparation Products And Raw materials |
|