- H-Val-OtBu·HCl
-
- $1.00
-
2020-01-06
- CAS:13211-31-9
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 100KG
- H-Val-OtBu·HCl
-
- $1.00
-
2020-01-06
- CAS:13211-31-9
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 100KG
|
| | tert-Butyl L-valinate Basic information |
| | tert-Butyl L-valinate Chemical Properties |
| Boiling point | 77-78 °C(Press: 12 Torr) | | density | 0.936±0.06 g/cm3(Predicted) | | storage temp. | -15°C | | form | liquid | | pka | 7.91±0.33(Predicted) | | color | Colourless | | InChI | InChI=1S/C9H19NO2/c1-6(2)7(10)8(11)12-9(3,4)5/h6-7H,10H2,1-5H3/t7-/m0/s1 | | InChIKey | RJBVJBGFJIHJSZ-ZETCQYMHSA-N | | SMILES | C(OC(C)(C)C)(=O)[C@H](C(C)C)N | | CAS DataBase Reference | 13211-31-9(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2922498590 |
| | tert-Butyl L-valinate Usage And Synthesis |
| Uses |
tert-Butyl L-valinate is a crucial compound that could be used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research.
|
| | tert-Butyl L-valinate Preparation Products And Raw materials |
|