|
|
| | Boc-piperazine hydrochloride Basic information |
| Product Name: | Boc-piperazine hydrochloride | | Synonyms: | BOC-PIZ;tert-butyl piperazine-1-carboxylate, HCl;Piperazine-1-carboxylic acid tert-butyl ester hydrochloride;tert-Butyl piperazine-1-carboxylate hydrochloride;BOC-PIZ HCL;BOC-PIPERAZINE HCL;BOC-PAZ HCL;N-(T-BUTYLOXYCARBONYL)-PIPERAZINE HYDROCHLORIDE | | CAS: | 76535-74-5 | | MF: | C9H19ClN2O2 | | MW: | 222.71 | | EINECS: | | | Product Categories: | | | Mol File: | 76535-74-5.mol |  |
| | Boc-piperazine hydrochloride Chemical Properties |
| storage temp. | Inert atmosphere,2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H18N2O2.ClH/c1-9(2,3)13-8(12)11-6-4-10-5-7-11;/h10H,4-7H2,1-3H3;1H | | InChIKey | DEGRJODPOICGRU-UHFFFAOYSA-N | | SMILES | C(N1CCNCC1)(=O)OC(C)(C)C.Cl |
| | Boc-piperazine hydrochloride Usage And Synthesis |
| | Boc-piperazine hydrochloride Preparation Products And Raw materials |
|