|
|
| | Ethyl N-cyanoethanimideate Basic information |
| Product Name: | Ethyl N-cyanoethanimideate | | Synonyms: | n-cyanoethanimidic acid ethyl ester;N-CYANOETHANIMIDIC ETHYL ESTER;ETHYLN-CYANOACETOIMIDATE;ETHYL N-CYANO ETHANIMIDATE;Ethyl N-cyanoethanimideate;CYANO ETHYL ACETAMIDATE;N-cyanoacetimidic acid ethyl ester;Ethyl N-cyanoacetiMidate | | CAS: | 1558-82-3 | | MF: | C5H8N2O | | MW: | 112.13 | | EINECS: | | | Product Categories: | john's | | Mol File: | 1558-82-3.mol |  |
| | Ethyl N-cyanoethanimideate Chemical Properties |
| Melting point | 78-81 °C(Solv: ethyl ether (60-29-7)) | | Boiling point | 133.2±23.0 °C(Predicted) | | density | 0.94 | | refractive index | 1.45 | | Fp | 34° | | storage temp. | 2-8°C | | pka | -2.94±0.50(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C5H8N2O/c1-3-8-5(2)7-4-6/h3H2,1-2H3 | | InChIKey | PLVWUINOWYHRAA-UHFFFAOYSA-N | | SMILES | C(=NC#N)(OCC)C | | CAS DataBase Reference | 1558-82-3(CAS DataBase Reference) |
| RIDADR | UN3273 | | HS Code | 2926.90.5050 | | HazardClass | 3, 6.1 |
| | Ethyl N-cyanoethanimideate Usage And Synthesis |
| Preparation | To a flask equipped as in Preparation 2-6 is added 162.0 gm (1.0 mole) of ethyl orthoacetate, 42.0 gm (1.0 mole) of cyanamide, and 134.0 gm (2.0 moles) of acetic anhydride. The reaction mixture is heated to 130-140°C and the ethyl acetate and acetic acid are distilled over. The heat is removed until the initial vigorous reaction subsides and then the heating is continued at 135-140°C until most of the remaining ethyl acetate and acetid acid have distilled over (approx. 1 hr). The residue is then distilled under reduced pressure to afford 100.8 gm (90%), b.p. 90-95°C (20 mm Hg).
 | | Synthesis | General methodology: The compound was synthesized with reference to literature methods. The standard procedure we used is detailed below: the mixed system of the original triethyl acetate (0.12 mol), cyanamide (0.1 mol) and a small amount of acetic acid (a few drops) was refluxed for 6 hours, followed by distillation and purification under reduced pressure (14 mmHg). | | References | [1] Phosphorus, Sulfur and Silicon and the Related Elements, 2016, vol. 191, # 5, p. 759 - 764
[2] Patent: US5750545, 1998, A
[3] Patent: WO2008/42928, 2008, A2. Location in patent: Page/Page column 33
[4] Journal of Organic Chemistry, 1963, vol. 28, p. 1816 - 1821 |
| | Ethyl N-cyanoethanimideate Preparation Products And Raw materials |
|