1-PYRENECARBOXYLIC ACID manufacturers
- 1-Pyrenecarboxylic acid 97%
-
- $15.00 / 1KG
-
2021-07-02
- CAS:19694-02-1
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 1-PYRENECARBOXYLIC ACID Basic information |
| | 1-PYRENECARBOXYLIC ACID Chemical Properties |
| Melting point | 270-272 °C (lit.) | | Boiling point | 329.26°C (rough estimate) | | density | 1.2132 (rough estimate) | | refractive index | 1.4770 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMF: soluble | | pka | 3.49±0.30(Predicted) | | form | powder to crystal | | color | Light yellow to Yellow to Green | | BRN | 2375854 | | InChI | InChI=1S/C17H10O2/c18-17(19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H,(H,18,19) | | InChIKey | HYISVWRHTUCNCS-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=C2C3=C4C(C=C2)=CC=CC4=CC=C3C=C1 |
| WGK Germany | 3 | | F | 8 | | HS Code | 29163990 |
| | 1-PYRENECARBOXYLIC ACID Usage And Synthesis |
| Uses | PCA can be used in the surface modification of graphene and carbon nanotubes (CNTs), which can further be used for a variety of electronic applications. | | General Description | 1-Pyrenecarboxylic acid (PCA) is a polyaromatic derivative that has an amphiphilic characteristic. It is a fluorophore that shows absorption spectra in the UV region. PCA has a carboxylic acid group that attaches with pyrene nucleus. It can be used as a sensitizer that facilitates the electron transport from one medium to another. | | Purification Methods | Crystallise the acid from *C6H6, chlorobenzene, nitrobenzene or 95% EtOH. [Beilstein 9 H 712, 9 III 3575.] |
| | 1-PYRENECARBOXYLIC ACID Preparation Products And Raw materials |
|