|
|
| | (Carbethoxymethyl)triphenylphosphonium bromide Basic information |
| | (Carbethoxymethyl)triphenylphosphonium bromide Chemical Properties |
| Melting point | 145-150 °C (dec.) (lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Crystalline Powder | | color | White | | Water Solubility | It is soluble in water. | | Sensitive | Hygroscopic | | BRN | 3581273 | | InChI | 1S/C22H22O2P.BrH/c1-2-24-22(23)18-25(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;/h3-17H,2,18H2,1H3;1H/q+1;/p-1 | | InChIKey | VJVZPTPOYCJFNI-UHFFFAOYSA-M | | SMILES | [Br-].CCOC(=O)C[P+](c1ccccc1)(c2ccccc2)c3ccccc3 | | CAS DataBase Reference | 1530-45-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | RTECS | TA2299500 | | F | 9 | | HS Code | 29310095 | | Storage Class | 11 - Combustible Solids |
| | (Carbethoxymethyl)triphenylphosphonium bromide Usage And Synthesis |
| Chemical Properties | WHITE CRYSTALLINE POWDER | | Uses | suzuki reaction | | Uses | (Ethoxycarbonylmethyl)triphenylphosphonium bromide, is used as a pharmaceutical intermediate. | | reaction suitability | reaction type: C-C Bond Formation | | Synthesis | Ethoxycarbonylmethyltriphenylphosphonium bromide was prepared as follows: ethyl acetate (5.0 L) was added to triphenylphosphonium, and ethyl bromoacetate (665 g, 4.01 mol) was added dropwise to the mixture with stirring, and after the dropwise addition the reaction mixture was stirred at room temperature for 24 hours. The mixture was then diafiltered and the filter cake was washed three times with ethyl acetate, using 500 mL each time. Vacuum drying of the filter cake gave ethoxymethyltriphenylphosphonium bromide [Ph 3 PCH 2 CO 2 Et]+Br- (1500 g) as a white solid in 92% yield.
| | Purification Methods | Wash it with pet ether (b 40-50o) and recrystallise it from CHCl3/Et2O and dry it in a high vacuum at 65o. [Isler et al. Helv Chim Acta 40 1242 1957, Wittig & Haag Chem Ber 88 1654, 1664 1955.] |
| | (Carbethoxymethyl)triphenylphosphonium bromide Preparation Products And Raw materials |
|