- METHOXYPHENONE
-
- $6.00 / 1KG
-
2025-09-25
- CAS:41295-28-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | METHOXYPHENONE Basic information |
| Product Name: | METHOXYPHENONE | | Synonyms: | HEXACONAZOL PESTANAL, 100 MG;3,3'-dimethyl-4-methoxybenzophenone;METHOXYPHENONE;KAYAMETONE;NK-049;Methoxyphenon;4-Methoxy-3-Methylphenyl 3-Methylphenyl ketone;(4-Methoxy-3-methylphenyl)(m-tolyl)methanone | | CAS: | 41295-28-7 | | MF: | C16H16O2 | | MW: | 240.3 | | EINECS: | 255-300-6 | | Product Categories: | | | Mol File: | 41295-28-7.mol |  |
| | METHOXYPHENONE Chemical Properties |
| Melting point | 62.25°C | | Boiling point | 343.02°C (rough estimate) | | density | 1.0752 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), DMSO (Slightly) | | form | Solid | | color | White to Pale Red | | Water Solubility | 2mg/L(20 ºC) | | InChI | InChI=1S/C16H16O2/c1-11-5-4-6-13(9-11)16(17)14-7-8-15(18-3)12(2)10-14/h4-10H,1-3H3 | | InChIKey | BWPYBAJTDILQPY-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(OC)C(C)=C1)(C1=CC=CC(C)=C1)=O |
| RTECS | PC4961000 | | HS Code | 29143990 |
| | METHOXYPHENONE Usage And Synthesis |
| Uses | Methoxyphenone is a pesticidal compound, and it is used in preparation of Nitrones as herbicides. | | Definition | ChEBI: Methoxyphenone is a member of benzophenones. |
| | METHOXYPHENONE Preparation Products And Raw materials |
|