|
|
| | BENZO(B)NAPHTHO(1,2-D)THIOPHENE Basic information |
| Product Name: | BENZO(B)NAPHTHO(1,2-D)THIOPHENE | | Synonyms: | BENZO(B)NAPHTHO(1,2-D)THIOPHENE;Benzo(B)naphtha(1,2-D)thiophene;naphtho[2,1-b][1]benzothiole;naphtho[2,1-b]benzothiophene;7-thiabenzo(c)fluorene;Benzo[b]naphtho[1,2-d]thiophene (purity);Benzo[b]naptho[2,1-d]thiophene;39696, Benzo[b]naphtho[1,2-d]thiophene ( purity) | | CAS: | 205-43-6 | | MF: | C16H10S | | MW: | 234.32 | | EINECS: | | | Product Categories: | Alphabetic;B;BA - BH | | Mol File: | 205-43-6.mol |  |
| | BENZO(B)NAPHTHO(1,2-D)THIOPHENE Chemical Properties |
| Melting point | 185℃ (acetic acid ) | | Boiling point | 220°C/0.2mmHg(lit.) | | density | 1.292±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | color | White to Orange to Green | | λmax | 351nm(CHCl3)(lit.) | | BRN | 9635 | | InChI | InChI=1S/C16H10S/c1-2-6-12-11(5-1)9-10-15-16(12)13-7-3-4-8-14(13)17-15/h1-10H | | InChIKey | XZUMOEVHCZXMTR-UHFFFAOYSA-N | | SMILES | C12=CC=CC=C1C1=C3C(C=CC=C3)=CC=C1S2 | | EPA Substance Registry System | Benzo[b]naphtho[1,2-d]thiophene (205-43-6) |
| RTECS | DI2340000 | | HS Code | 2934.99.4400 |
| | BENZO(B)NAPHTHO(1,2-D)THIOPHENE Usage And Synthesis |
| Chemical Properties | White powder |
| | BENZO(B)NAPHTHO(1,2-D)THIOPHENE Preparation Products And Raw materials |
|