- Methyl 3,5-Dinitrobenzoate
-
- $39.07 / 25Kg/Drum
-
2026-01-21
- CAS:2702-58-1
- Min. Order: 25Kg/Drum
- Purity: 99.00%HPLC
- Supply Ability: 10tons/month
|
| | Methyl 3,5-dinitrobenzoate Basic information |
| Product Name: | Methyl 3,5-dinitrobenzoate | | Synonyms: | Benzoic acid, 3,5-dinitro-, methyl ester;3,5-DINITROBENZOIC ACID METHYL ESTER;METHYL 3,5-DINITROBENZOATE;3,3,5-Dinitrobenzoic acid methyl ester;3,5- twoNitrobenzoic AcidMethyl Ester;NSC 7317;Methyl 3,5-dinitrobenzoate,99%;2-methyl-3,5-dinitrobenzoate | | CAS: | 2702-58-1 | | MF: | C8H6N2O6 | | MW: | 226.14 | | EINECS: | 220-289-9 | | Product Categories: | Aromatic Esters;C8 to C9;Carbonyl Compounds;Esters | | Mol File: | 2702-58-1.mol |  |
| | Methyl 3,5-dinitrobenzoate Chemical Properties |
| Melting point | 107-109 °C (lit.) | | Boiling point | 367.74°C (rough estimate) | | density | 1.6136 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Store at room temperature | | form | powder | | Appearance | White to off-white Solid | | BRN | 1252593 | | InChI | 1S/C8H6N2O6/c1-16-8(11)5-2-6(9(12)13)4-7(3-5)10(14)15/h2-4H,1H3 | | InChIKey | POGCCFLNFPIIGW-UHFFFAOYSA-N | | SMILES | COC(=O)c1cc(cc(c1)[N+]([O-])=O)[N+]([O-])=O | | CAS DataBase Reference | 2702-58-1(CAS DataBase Reference) | | NIST Chemistry Reference | Methyl 3,5-dinitrobenzoate(2702-58-1) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Methyl 3,5-dinitrobenzoate Usage And Synthesis |
| Chemical Properties | pale yellow crystalline powder | | Uses | cleaning products
cosmetics
flavors and fragrances
food and beverages
personal care
pharmaceutical | | Synthesis Reference(s) | Synthetic Communications, 12, p. 1139, 1982 DOI: 10.1080/00397918208065981 |
| | Methyl 3,5-dinitrobenzoate Preparation Products And Raw materials |
|