|
|
| | 2-(2-Aminoethyl)-1-methylpyrrolidine Basic information |
| | 2-(2-Aminoethyl)-1-methylpyrrolidine Chemical Properties |
| Boiling point | 152.7±8.0 °C(Predicted) | | density | 0.885 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.4684(lit.) | | Fp | 149 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 10.34±0.40(Predicted) | | form | Powder | | color | Light beige to light brown | | InChI | InChI=1S/C7H16N2/c1-9-6-2-3-7(9)4-5-8/h7H,2-6,8H2,1H3 | | InChIKey | PNHGJPJOMCXSKN-UHFFFAOYSA-N | | SMILES | N1(C)CCCC1CCN | | CAS DataBase Reference | 51387-90-7(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-39 | | RIDADR | 2735 | | WGK Germany | 2 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29339900 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 2-(2-Aminoethyl)-1-methylpyrrolidine Usage And Synthesis |
| Chemical Properties | Clear colorless to pale yellow liquid | | Uses | 2-(2-Aminoethyl)-1-methylpyrrolidine is used as an electrochemiluminescence probe within microfluidic chip for ECL detection. 2-(2-Aminoethyl)-1-methylpyrrolidine is also used in chemical microarrays
to identify ligands that bind pathogenic cells. | | Uses | 2-(2-Aminoethyl)-1-methylpyrrolidine was used in dual-cloud point extraction and tertiary amine labeling for the quantification of indole-3-acetic acid and indole-3-butyric acid. | | General Description | 2-(2-Aminoethyl)-1-methylpyrrolidine labelling acts as probe within microfluidic chip for electrochemiluminescence detection. It acts as electrogenerated chemiluminescence derivatization reagent for carboxylic acid in HPLC. |
| | 2-(2-Aminoethyl)-1-methylpyrrolidine Preparation Products And Raw materials |
|