- 4,4'-Dimethylbiphenyl
-
- $1.00 / 1KG
-
2019-07-06
- CAS:613-33-2
- Min. Order: 1KG
- Purity: 96%
- Supply Ability: 1ton
|
| | 4,4'-Dimethylbiphenyl Basic information |
| | 4,4'-Dimethylbiphenyl Chemical Properties |
| Melting point | 118-120 °C(lit.) | | Boiling point | 295 °C(lit.) | | density | 0.9170 | | refractive index | 1.5811 (estimate) | | Fp | 295°C | | storage temp. | Sealed in dry,Room Temperature | | form | Crystalline Powder | | color | White to light yellow | | Water Solubility | Insoluble in water. | | BRN | 1856053 | | InChI | InChI=1S/C14H14/c1-11-3-7-13(8-4-11)14-9-5-12(2)6-10-14/h3-10H,1-2H3 | | InChIKey | RZTDESRVPFKCBH-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(C)C=C2)=CC=C(C)C=C1 | | LogP | 5.090 | | CAS DataBase Reference | 613-33-2(CAS DataBase Reference) | | NIST Chemistry Reference | 4,4'-Dimethylbiphenyl(613-33-2) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29029090 | | Storage Class | 10 - Combustible liquids |
| | 4,4'-Dimethylbiphenyl Usage And Synthesis |
| Chemical Properties | Crystalline | | Uses | 4,4'-Dimethylbiphenyl is used in the preparation of biphenyl-4,4?-dicarboxylic acid, which acts as a monomer utilized in the synthesis of linear long chain polymer through polycondensation reaction. It is used to prepare 4-(4'-methylphenyl)benzaldehyde by selective photoxygenation reaction using 9-phenyl-10-methylacridinium perchlorate as a catalyst under visible light irradiation. | | Synthesis Reference(s) | Tetrahedron Letters, 21, p. 631, 1980 DOI: 10.1016/S0040-4039(01)85577-5
Journal of the American Chemical Society, 90, p. 2423, 1968 DOI: 10.1021/ja01011a041 |
| | 4,4'-Dimethylbiphenyl Preparation Products And Raw materials |
|