| Company Name: |
Chemwill Asia Co.,Ltd.
|
| Tel: |
86-21-51086038 |
| Email: |
chemwill_asia@126.com |
| Products Intro: |
CAS:97534-82-2 Purity:99% Package:5KG;1KG;25KG
|
| Company Name: |
ZHIWE CHEMTECH CO LTD
|
| Tel: |
021-20221225 13917446399 |
| Email: |
zwchem@163.com |
| Products Intro: |
Product Name:(S)-(-)-3-Cbz-4-oxazolidinecarboxylic acid CAS:97534-82-2 Package:100g
|
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Products Intro: |
Product Name:(S)-(-)-3-(Benzyloxycarbonyl)oxazolidine-4-carboxylic acid, 98% CAS:97534-82-2 Package:1g Remarks:H27056
|
|
| | (S)-(-)-3-Z-4-OXAZOLIDINECARBOXYLIC ACID Basic information |
| | (S)-(-)-3-Z-4-OXAZOLIDINECARBOXYLIC ACID Chemical Properties |
| Melting point | 74-78 °C(lit.) | | alpha | -92°(20℃, c=1, CHCl3) | | Boiling point | 454.8±45.0 °C(Predicted) | | density | 1.385 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 3.51±0.20(Predicted) | | form | powder | | color | White | | Optical Rotation | [α]20/D 92°, c = 1 in chloroform | | InChI | 1S/C12H13NO5/c14-11(15)10-7-17-8-13(10)12(16)18-6-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,15)/t10-/m0/s1 | | InChIKey | XRRRGBIMHQARMF-JTQLQIEISA-N | | SMILES | OC(=O)[C@@H]1COCN1C(=O)OCc2ccccc2 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | (S)-(-)-3-Z-4-OXAZOLIDINECARBOXYLIC ACID Usage And Synthesis |
| Chemical Properties | White powder |
| | (S)-(-)-3-Z-4-OXAZOLIDINECARBOXYLIC ACID Preparation Products And Raw materials |
|