- Enalapril IMpurity B
-
- $29.00 / 500mg
-
2026-05-11
- CAS:82717-96-2
- Min. Order:
- Purity: 99.93%
- Supply Ability: 10g
- Imidapril Impurity 3
-
- $0.00 / 10mg
-
2026-03-12
- CAS:82717-96-2
- Min. Order: 10mg
- Purity: 98%
- Supply Ability: 500mg
|
| | N-[(S)-(+)-1-(Ethoxycarbonyl)-3-phenylpropyl]-L-alanine Basic information |
| | N-[(S)-(+)-1-(Ethoxycarbonyl)-3-phenylpropyl]-L-alanine Chemical Properties |
| Melting point | 150-152 °C(lit.) | | alpha | +28° (20℃/D)(c=1, CH3OH) | | Boiling point | 422.1°C (rough estimate) | | density | 1.1083 (rough estimate) | | vapor pressure | 1.95hPa at 25℃ | | refractive index | 29.5 ° (C=1, MeOH) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | 6g/l | | pka | 2.14±0.10(Predicted) | | form | Crystalline Powder | | color | White | | Optical Rotation | [α]20/D +28°, c = 1 in methanol | | Water Solubility | 100mg/L at 25℃ | | BRN | 3619501 | | Major Application | peptide synthesis | | InChI | 1S/C15H21NO4/c1-3-20-15(19)13(16-11(2)14(17)18)10-9-12-7-5-4-6-8-12/h4-8,11,13,16H,3,9-10H2,1-2H3,(H,17,18)/t11-,13-/m0/s1 | | InChIKey | CEIWXEQZZZHLDM-AAEUAGOBSA-N | | SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(O)=O | | LogP | 0.12 at 25℃ | | CAS DataBase Reference | 82717-96-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-36 | | WGK Germany | 3 | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids |
| | N-[(S)-(+)-1-(Ethoxycarbonyl)-3-phenylpropyl]-L-alanine Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Moexipril intermediate; the main metabolite of Imidapril. | | Uses | An intermediate in the synthesis of Ramipril | | Flammability and Explosibility | Non flammable | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-[(S)-(+)-1-(Ethoxycarbonyl)-3-phenylpropyl]-L-alanine Preparation Products And Raw materials |
| Raw materials | Benzenebutanoic acid, α-[[(1S)-1-methyl-2-oxo-2-(phenylmethoxy)ethyl]amino]-, ethyl ester, (αS)--->Benzenebutanoic acid, α-[[(1S)-2-(1,1-dimethylethoxy)-1-methyl-2-oxoethyl]amino]-, ethyl ester, (αS)--->Benzenebutanoic acid, a-bromo-, ethyl ester-->Benzenebutanoic acid, α-[[(1S)-1-methyl-2-oxo-2-(phenylmethoxy)ethyl]amino]-γ-oxo-, ethyl ester, (αS)--->DL-Homophenylalanine-->L-Alanine benzyl ester 4-toluenesulfonate-->L-Homophenylalanine ethyl ester hydrochloride-->2-bromo-4-phenylbutyric acid-->L-Ala-OtBU.HCl-->L-Homophe-OH-->Enalapril diketopiperazine-->L-Homophenylalanine ethyl ester-->Ethyl trans-3-Benzoylacrylate-->L-ALANINE BENZYL ESTER-->Enalapril-->Enalaprilat-->2-acetamido-4-phenyl-butanoic acid-->L-Proline |
|