|
|
| | 3-Amino-3-(2,4-dichloro-phenyl)-propan-1-ol Basic information |
| | 3-Amino-3-(2,4-dichloro-phenyl)-propan-1-ol Chemical Properties |
| Boiling point | 361.1±37.0 °C(Predicted) | | density | 1.337±0.06 g/cm3(Predicted) | | pka | 14.81±0.10(Predicted) | | form | solid | | InChI | 1S/C9H11Cl2NO/c10-6-1-2-7(8(11)5-6)9(12)3-4-13/h1-2,5,9,13H,3-4,12H2 | | InChIKey | BJSTYZZLZITDJR-UHFFFAOYSA-N | | SMILES | ClC1=C(C(CCO)N)C=CC(Cl)=C1 |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | HS Code | 2922190090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | 3-Amino-3-(2,4-dichloro-phenyl)-propan-1-ol Usage And Synthesis |
| | 3-Amino-3-(2,4-dichloro-phenyl)-propan-1-ol Preparation Products And Raw materials |
|