| Company Name: |
Shanghai CR Corporation Limited
|
| Tel: |
13062833949; 4006653949 4006653949 |
| Email: |
fred.wen@crcorporation.cn |
| Products Intro: |
Product Name:3-AMINO-3-(2,4-DICHLORO-PHENYL)-PROPAN-1-OL CAS:787615-23-0 Purity:98+ Package:1g/瓶
|
| Company Name: |
Hebei Boxin Biotechnology Co. , Ltd.
|
| Tel: |
19131160546 |
| Email: |
2681315246@qq.com |
| Products Intro: |
Product Name:3-AMINO-3-(2,4-DICHLORO-PHENYL)-PROPAN-1-OL CAS:787615-23-0 Purity:98% HPLC Package:10G;100G;500G;1KG;25KG;
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:3-Amino-3-(2,4-dichloro-phenyl)-propan-1-ol
|
| Company Name: |
Santa Cruz Biotechnology Inc
|
| Tel: |
021-60936350 |
| Email: |
scbt@scbt.com |
| Products Intro: |
Product Name:3-Amino-3-(2,4-dichloro-phenyl)-propan-1-ol CAS:787615-23-0
|
| Company Name: |
labter pharmatech(beijing) co.,ltd
|
| Tel: |
18310155299 |
| Email: |
office@labter.com.cn |
| Products Intro: |
Product Name:3-AMINO-3-(2,4-DICHLORO-PHENYL)-PROPAN-1-OL CAS:787615-23-0 Purity:95% HPLC Package:1g;5g;10g;25g;100g;250g;500g;1kg
|
|
| | 3-AMINO-3-(2,4-DICHLORO-PHENYL)-PROPAN-1-OL Basic information |
| | 3-AMINO-3-(2,4-DICHLORO-PHENYL)-PROPAN-1-OL Chemical Properties |
| Boiling point | 361.1±37.0 °C(Predicted) | | density | 1.337±0.06 g/cm3(Predicted) | | form | solid | | pka | 14.81±0.10(Predicted) | | InChI | 1S/C9H11Cl2NO/c10-6-1-2-7(8(11)5-6)9(12)3-4-13/h1-2,5,9,13H,3-4,12H2 | | InChIKey | BJSTYZZLZITDJR-UHFFFAOYSA-N | | SMILES | ClC1=C(C(CCO)N)C=CC(Cl)=C1 |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | HS Code | 2922190090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | 3-AMINO-3-(2,4-DICHLORO-PHENYL)-PROPAN-1-OL Usage And Synthesis |
| | 3-AMINO-3-(2,4-DICHLORO-PHENYL)-PROPAN-1-OL Preparation Products And Raw materials |
|