|
|
| | 1,1,1,3,3,3-HEXAFLUORO-2-PHENYL-2-PROPANOL Basic information |
| Product Name: | 1,1,1,3,3,3-HEXAFLUORO-2-PHENYL-2-PROPANOL | | Synonyms: | alpha,alpha-bis(trifluoromethyl)-benzenemethano;Benzenemethanol, alpha,alpha-bis(trifluoromethyl)-;Hexafluoro-2-phenyl-2-propanol;2-HYDROXY-2-PHENYLHEXAFLUOROPROPANE;2,2,2,2,2,2,-HEXAFLUOROCUMYL ALCOHOL;2,2,2,2',2',2'-HEXAFLUOROCUMYL ALCOHOL;1,1,1,3,3,3-HEXAFLUORO-2-PHENYL-2-PROPANOL;(HEXAFLUORO-2-HYDROXYISOPROPYL)BENZENE | | CAS: | 718-64-9 | | MF: | C9H6F6O | | MW: | 244.13 | | EINECS: | 211-943-4 | | Product Categories: | | | Mol File: | 718-64-9.mol |  |
| | 1,1,1,3,3,3-HEXAFLUORO-2-PHENYL-2-PROPANOL Chemical Properties |
| Boiling point | 160 °C(lit.) | | density | 1.45 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.415(lit.) | | Fp | 140 °F | | storage temp. | Sealed in dry,Room Temperature | | pka | 9.20±0.10(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | BRN | 2053547 | | InChI | 1S/C9H6F6O/c10-8(11,12)7(16,9(13,14)15)6-4-2-1-3-5-6/h1-5,16H | | InChIKey | IZPIZCAYJQCTNG-UHFFFAOYSA-N | | SMILES | OC(c1ccccc1)(C(F)(F)F)C(F)(F)F | | CAS DataBase Reference | 718-64-9(CAS DataBase Reference) | | EPA Substance Registry System | Benzenemethanol, .alpha.,.alpha.-bis(trifluoromethyl)- (718-64-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | UN 1987 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29062990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | 1,1,1,3,3,3-HEXAFLUORO-2-PHENYL-2-PROPANOL Usage And Synthesis |
| Synthesis Reference(s) | The Journal of Organic Chemistry, 30, p. 998, 1965 DOI: 10.1021/jo01015a009 | | Biochem/physiol Actions | 1,1,1,3,3,3-Hexafluoro-2-phenyl-2-propanol is an effective solvent for Cu(0)-mediated single electron transfer-living radical polymerization of methyl methacrylate and polymerization of styrene. |
| | 1,1,1,3,3,3-HEXAFLUORO-2-PHENYL-2-PROPANOL Preparation Products And Raw materials |
|