- CYCLO(-PHE-PRO)
-
- $1.00
-
2024-07-20
- CAS:3705-26-8
- Min. Order: 1Kg
- Purity: 98%
- Supply Ability: 20T
|
| | CYCLO(-PHE-PRO) Basic information |
| Product Name: | CYCLO(-PHE-PRO) | | Synonyms: | (3S-trans)-3-benzylhexahydropyrrolo[1,2-a]pyrazine-1,4-dione;(3S,8aS)-3-Benzyl-6,7,8,8aα-tetrahydropyrrolo[1,2-a]pyrazine-1,4(2H,3H)-dione;(3S,8aS)-3β-Benzyl-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-1,4(2H,3H)-dione;(3S,8aα)-3β-Benzyloctahydropyrrolo[1,2-a]pyrazine-1,4-dione;Cyclo(L-Phe-L-Pro-);Cyclo(Pro-Phe-);(3S)-2,3,6,7,8,8aβ-Hexahydro-3β-(phenylmethyl)pyrrolo[1,2-a]pyrazine-1,4-dione;Cyclo(D-Pro-L-Phe-) | | CAS: | 3705-26-8 | | MF: | C14H16N2O2 | | MW: | 244.29 | | EINECS: | 223-047-0 | | Product Categories: | | | Mol File: | 3705-26-8.mol |  |
| | CYCLO(-PHE-PRO) Chemical Properties |
| Melting point | 146-148 °C | | Boiling point | 509.5±39.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | -15°C | | solubility | Chloroform (Slightly), Ethanol (Slightly, Sonicated) | | form | Solid | | pka | 13.21±0.40(Predicted) | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | 1S/C14H16N2O2/c17-13-12-7-4-8-16(12)14(18)11(15-13)9-10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9H2,(H,15,17)/t11-,12-/m0/s1 | | InChIKey | QZBUWPVZSXDWSB-RYUDHWBXSA-N | | SMILES | N21[C@@H](CCC2)C(=O)N[C@H](C1=O)Cc3ccccc3 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | CYCLO(-PHE-PRO) Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Cyclo(L-prolyl-L-phenylalanyl) is a diketopiperazine derivative isolated from Bacillus thuringiensis and Bacillus endophyticus. | | Uses | Cyclo(L-Phe-L-Pro) is a diketopiperazine formed by the fusion of phenylalanine and proline, reported as a secondary metabolite of fungi and bacteria. In Pseudomonas aeruginosa, cyclo(L-Phe-L-Pro) is capable of activating N-acylhomoserine lactones (AHLs). Cyclo(L-Phe-L-Pro) is also capable of activating or antagonizing other LuxR-based quorum-sensing systems. While the mode of action of cyclo(L-Phe-L-Pro) is not known, its activity suggests the existence of cross talk among bacterial signalling systems. | | Definition | ChEBI: Cyclo(L-Phe-L-Pro) is an organic molecular entity. It has a role as a metabolite. |
| | CYCLO(-PHE-PRO) Preparation Products And Raw materials |
|