|
|
| | Methyl 3-bromo-4-methylbenzoate Basic information |
| | Methyl 3-bromo-4-methylbenzoate Chemical Properties |
| Melting point | 38-44 °C(lit.) | | Boiling point | 130°C/0.1mmHg(lit.) | | density | 1.433±0.06 g/cm3(Predicted) | | refractive index | 1.5570 to 1.5610 | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in dimethyl sulfoxide. | | form | clear liquid | | color | Colorless to Light orange to Yellow | | InChI | InChI=1S/C9H9BrO2/c1-6-3-4-7(5-8(6)10)9(11)12-2/h3-5H,1-2H3 | | InChIKey | MASRAGFWFYHMFI-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C(C)C(Br)=C1 | | CAS DataBase Reference | 104901-43-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2916399090 |
| | Methyl 3-bromo-4-methylbenzoate Usage And Synthesis |
| Chemical Properties | Orange-red solid | | Uses | It is a pharmaceutical intermediate. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 53, p. 5545, 1988 DOI: 10.1021/jo00258a030 | | Synthesis | The general procedure for the synthesis of methyl 3-bromo-4-methylbenzoate from methanol and 3-bromo-4-methylbenzoic acid was as follows: 3-bromo-4-methylbenzoic acid (2.0 g, 9.30 mmol) was suspended in methanol (20 ml), and sulfuric acid (0.04 ml) was added as a catalyst. The reaction mixture was stirred at 60°C for 42 hours. After completion of the reaction, the reaction mixture was concentrated and the residue was dissolved in ethyl acetate. The organic phase was washed with saturated aqueous sodium bicarbonate, dried over anhydrous magnesium sulfate, filtered and concentrated to afford the title compound methyl 3-bromo-4-methylbenzoate as an orange oil (2.25 g, quantitative yield), which could be used for subsequent experiments without further purification. | | References | [1] Patent: US2013/237537, 2013, A1. Location in patent: Paragraph 0330-0331
[2] Patent: WO2013/119946, 2013, A1. Location in patent: Paragraph 0198; 0345
[3] Patent: WO2011/107608, 2011, A1. Location in patent: Page/Page column 69
[4] Bioorganic and Medicinal Chemistry Letters, 2013, vol. 23, # 23, p. 6442 - 6446
[5] Patent: WO2006/4903, 2006, A2. Location in patent: Page/Page column 125 |
| | Methyl 3-bromo-4-methylbenzoate Preparation Products And Raw materials |
|