|
|
| | 2',3',5'-Tri-O-acetyl-D-adenosine Basic information |
| Product Name: | 2',3',5'-Tri-O-acetyl-D-adenosine | | Synonyms: | 2',3',5'-TRI-O-ACETYLADENOSINE;2',3',5'-Tri-O-acetyl-D-adenosine;Nsc 76766;2',3',5'-Tri-O-acetyl-D-adenosine ,98%;6-aMino-9-[(2,3,5-tri-O-acetyl)-β-D-ribofuranosyl]purine;2,3,5-TRIACETYLADENOSINE;-Tri-O-acetyl-D-adenosine;Tri-O-acetyladenosine | | CAS: | 7387-57-7 | | MF: | C16H19N5O7 | | MW: | 393.35 | | EINECS: | | | Product Categories: | Bases & Related Reagents;Nucleotides;Biochemicals and Reagents;Nucleoside Analogs;Nucleosides, Nucleotides, Oligonucleotides | | Mol File: | 7387-57-7.mol |  |
| | 2',3',5'-Tri-O-acetyl-D-adenosine Chemical Properties |
| Melting point | 168-170°C | | Boiling point | 594.1±60.0 °C(Predicted) | | density | 1.62±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | solubility | Chloroform (Sparingly), DMSO (Slightly), Methanol (Sparingly) | | form | Solid | | pka | 3.82±0.10(Predicted) | | color | White to Off-White | | Optical Rotation | -30.7°(C=0.007101g/ml CHCL3) | | InChIKey | GCVZNVTXNUTBFB-XNIJJKJLSA-N | | SMILES | C(OC(=O)C)[C@H]1O[C@@H](N2C3C(=C(N=CN=3)N)N=C2)[C@H](OC(=O)C)[C@@H]1OC(=O)C | | CAS DataBase Reference | 7387-57-7(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29349990 |
| | 2',3',5'-Tri-O-acetyl-D-adenosine Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 2',3',5'-Tri-O-acetyladenosine is a synthetic nucleotide analog that binds to the adenine nucleotide of DNA. It is a cross-linking agent that can be used for the preparation of insoluble complexes with other proteins or nucleic acids. |
| | 2',3',5'-Tri-O-acetyl-D-adenosine Preparation Products And Raw materials |
|