|
|
| | 6-Aminotetramethylrhodamine Basic information |
| Product Name: | 6-Aminotetramethylrhodamine | | Synonyms: | 6-AMINO TMR;6-AminoTAMRA *Single Isomer* [6-Aminotetramethylrhodamine];9-(5-Amino-2-carboxyphenyl)-3,6-bis(dimethylamino)xanthylium inner salt;4-Amino-2-(3,6-bis(dimethylamino)xanthylium-9-yl)benzoate;6-amTMR;ATT0 425 acid;6-Aminotetramethylrhodamine | | CAS: | 80724-18-1 | | MF: | C24H23N3O3 | | MW: | 401.46 | | EINECS: | | | Product Categories: | | | Mol File: | 80724-18-1.mol |  |
| | 6-Aminotetramethylrhodamine Chemical Properties |
| Melting point | >300°C (dec.) | | storage temp. | -20°C Freezer | | solubility | DMSO, Methanol | | form | Solid | | color | Dark Purple | | InChI | InChI=1S/C24H23N3O3/c1-26(2)15-6-9-18-21(12-15)30-22-13-16(27(3)4)7-10-19(22)23(18)20-11-14(25)5-8-17(20)24(28)29/h5-13H,25H2,1-4H3 | | InChIKey | HJAKLXHVIVAHAX-UHFFFAOYSA-N | | SMILES | C([O-])(=O)C1=CC=C(N)C=C1C1=C2C(C=C(N(C)C)C=C2)=[O+]C2=C1C=CC(N(C)C)=C2 |
| | 6-Aminotetramethylrhodamine Usage And Synthesis |
| | 6-Aminotetramethylrhodamine Preparation Products And Raw materials |
|